C39H33ClFN3O5S2 — CID 19321899
methyl 2-[2-[3-[[(E)-2-benzamido-3-(2-chloro-6-fluorophenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate (PubChem CID 19321899) has the molecular formula C39H33ClFN3O5S2 and a molecular weight of 742.29 g/mol. Its IUPAC name is methyl 2-[2-[3-[[(E)-2-benzamido-3-(2-chloro-6-fluorophenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[2-[3-[[(E)-2-benzamido-3-(2-chloro-6-fluorophenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19321899 |
| Molecular Formula | C39H33ClFN3O5S2 |
| Molecular Weight | 742.29 g/mol |
| Exact Mass | 741.15 |
| IUPAC Name | methyl 2-[2-[3-[[(E)-2-benzamido-3-(2-chloro-6-fluorophenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate |
| SMILES | CCC(Sc1cccc(NC(=O)/C(=C\c2c(F)cccc2Cl)NC(=O)c2ccccc2)c1)C(=O)Nc1scc(-c2ccc(C)cc2)c1C(=O)OC |
| InChI | InChI=1S/C39H33ClFN3O5S2/c1-4-33(37(47)44-38-34(39(48)49-3)29(22-50-38)24-18-16-23(2)17-19-24)51-27-13-8-12-26(20-27)42-36(46)32(21-28-30(40)14-9-15-31(28)41)43-35(45)25-10-6-5-7-11-25/h5-22,33H,4H2,1-3H3,(H,42,46)(H,43,45)(H,44,47)/b32-21+ |
| InChIKey | IMYNRNYWFCHIRD-RUMWWMSVSA-N |
| XLogP | 9.22 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.29 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|