C37H29Cl2N3O5S2 — CID 19050874
methyl 2-[[2-[3-[[(E)-2-benzamido-3-(2,6-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate (PubChem CID 19050874) has the molecular formula C37H29Cl2N3O5S2 and a molecular weight of 730.70 g/mol. Its IUPAC name is methyl 2-[[2-[3-[[(E)-2-benzamido-3-(2,6-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[3-[[(E)-2-benzamido-3-(2,6-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19050874 |
| Molecular Formula | C37H29Cl2N3O5S2 |
| Molecular Weight | 730.70 g/mol |
| Exact Mass | 729.09 |
| IUPAC Name | methyl 2-[[2-[3-[[(E)-2-benzamido-3-(2,6-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(C)cc2)csc1NC(=O)CSc1cccc(NC(=O)/C(=C\c2c(Cl)cccc2Cl)NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C37H29Cl2N3O5S2/c1-22-14-16-23(17-15-22)28-20-49-36(33(28)37(46)47-2)42-32(43)21-48-26-11-6-10-25(18-26)40-35(45)31(19-27-29(38)12-7-13-30(27)39)41-34(44)24-8-4-3-5-9-24/h3-20H,21H2,1-2H3,(H,40,45)(H,41,44)(H,42,43)/b31-19+ |
| InChIKey | MWFJOFRMVYVVQF-ZCTHSVRISA-N |
| XLogP | 8.96 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.70 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|