C40H37N3O7S2 — CID 19051139
ethyl 2-[[2-[3-[[(E)-2-benzamido-3-(2,4-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate (PubChem CID 19051139) has the molecular formula C40H37N3O7S2 and a molecular weight of 735.88 g/mol. Its IUPAC name is ethyl 2-[[2-[3-[[(E)-2-benzamido-3-(2,4-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[3-[[(E)-2-benzamido-3-(2,4-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19051139 |
| Molecular Formula | C40H37N3O7S2 |
| Molecular Weight | 735.88 g/mol |
| Exact Mass | 735.21 |
| IUPAC Name | ethyl 2-[[2-[3-[[(E)-2-benzamido-3-(2,4-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(C)cc2)csc1NC(=O)CSc1cccc(NC(=O)/C(=C\c2ccc(OC)cc2OC)NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C40H37N3O7S2/c1-5-50-40(47)36-32(26-16-14-25(2)15-17-26)23-52-39(36)43-35(44)24-51-31-13-9-12-29(21-31)41-38(46)33(42-37(45)27-10-7-6-8-11-27)20-28-18-19-30(48-3)22-34(28)49-4/h6-23H,5,24H2,1-4H3,(H,41,46)(H,42,45)(H,43,44)/b33-20+ |
| InChIKey | VDWGQUDFYOXJMT-FMFFXOCNSA-N |
| XLogP | 8.06 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.88 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|