C37H29Cl2N3O5S2 — CID 19050745
ethyl 2-[[2-[3-[[(E)-2-benzamido-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-4-phenylthiophene-3-carboxylate (PubChem CID 19050745) has the molecular formula C37H29Cl2N3O5S2 and a molecular weight of 730.70 g/mol. Its IUPAC name is ethyl 2-[[2-[3-[[(E)-2-benzamido-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[3-[[(E)-2-benzamido-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19050745 |
| Molecular Formula | C37H29Cl2N3O5S2 |
| Molecular Weight | 730.70 g/mol |
| Exact Mass | 729.09 |
| IUPAC Name | ethyl 2-[[2-[3-[[(E)-2-benzamido-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]phenyl]sulfanylacetyl]amino]-4-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)CSc1cccc(NC(=O)/C(=C\c2ccc(Cl)cc2Cl)NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C37H29Cl2N3O5S2/c1-2-47-37(46)33-29(23-10-5-3-6-11-23)21-49-36(33)42-32(43)22-48-28-15-9-14-27(20-28)40-35(45)31(18-25-16-17-26(38)19-30(25)39)41-34(44)24-12-7-4-8-13-24/h3-21H,2,22H2,1H3,(H,40,45)(H,41,44)(H,42,43)/b31-18+ |
| InChIKey | XAGOYSRTRWMANV-FDAWAROLSA-N |
| XLogP | 9.04 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.70 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|