C29H25ClN2O4S2 — CID 18909421
ethyl 2-[[2-[3-[[2-(4-chlorophenyl)acetyl]amino]phenyl]sulfanylacetyl]amino]-4-phenylthiophene-3-carboxylate (PubChem CID 18909421) has the molecular formula C29H25ClN2O4S2 and a molecular weight of 565.12 g/mol. Its IUPAC name is ethyl 2-[[2-[3-[[2-(4-chlorophenyl)acetyl]amino]phenyl]sulfanylacetyl]amino]-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[3-[[2-(4-chlorophenyl)acetyl]amino]phenyl]sulfanylacetyl]amino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 18909421 |
| Molecular Formula | C29H25ClN2O4S2 |
| Molecular Weight | 565.12 g/mol |
| Exact Mass | 564.09 |
| IUPAC Name | ethyl 2-[[2-[3-[[2-(4-chlorophenyl)acetyl]amino]phenyl]sulfanylacetyl]amino]-4-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)CSc1cccc(NC(=O)Cc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C29H25ClN2O4S2/c1-2-36-29(35)27-24(20-7-4-3-5-8-20)17-38-28(27)32-26(34)18-37-23-10-6-9-22(16-23)31-25(33)15-19-11-13-21(30)14-12-19/h3-14,16-17H,2,15,18H2,1H3,(H,31,33)(H,32,34) |
| InChIKey | QHONQSWDKRVURX-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.12 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|