C22H18ClN5O3S2 — CID 2132558
ethyl 4-(4-chlorophenyl)-2-[[2-(1-phenyltetrazol-5-yl)sulfanylacetyl]amino]thiophene-3-carboxylate (PubChem CID 2132558) has the molecular formula C22H18ClN5O3S2 and a molecular weight of 500.01 g/mol. Its IUPAC name is ethyl 4-(4-chlorophenyl)-2-[[2-(1-phenyltetrazol-5-yl)sulfanylacetyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-(4-chlorophenyl)-2-[[2-(1-phenyltetrazol-5-yl)sulfanylacetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 2132558 |
| Molecular Formula | C22H18ClN5O3S2 |
| Molecular Weight | 500.01 g/mol |
| Exact Mass | 499.05 |
| IUPAC Name | ethyl 4-(4-chlorophenyl)-2-[[2-(1-phenyltetrazol-5-yl)sulfanylacetyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(Cl)cc2)csc1NC(=O)CSc1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C22H18ClN5O3S2/c1-2-31-21(30)19-17(14-8-10-15(23)11-9-14)12-32-20(19)24-18(29)13-33-22-25-26-27-28(22)16-6-4-3-5-7-16/h3-12H,2,13H2,1H3,(H,24,29) |
| InChIKey | PEJUAORXDNSVLY-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.01 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|