C21H16ClN5O3S2 — CID 24569343
methyl 4-(2-chlorophenyl)-2-[[2-(1-phenyltetrazol-5-yl)sulfanylacetyl]amino]thiophene-3-carboxylate (PubChem CID 24569343) has the molecular formula C21H16ClN5O3S2 and a molecular weight of 485.98 g/mol. Its IUPAC name is methyl 4-(2-chlorophenyl)-2-[[2-(1-phenyltetrazol-5-yl)sulfanylacetyl]amino]thiophene-3-carboxylate.
| Compound Name | methyl 4-(2-chlorophenyl)-2-[[2-(1-phenyltetrazol-5-yl)sulfanylacetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 24569343 |
| Molecular Formula | C21H16ClN5O3S2 |
| Molecular Weight | 485.98 g/mol |
| Exact Mass | 485.04 |
| IUPAC Name | methyl 4-(2-chlorophenyl)-2-[[2-(1-phenyltetrazol-5-yl)sulfanylacetyl]amino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccccc2Cl)csc1NC(=O)CSc1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C21H16ClN5O3S2/c1-30-20(29)18-15(14-9-5-6-10-16(14)22)11-31-19(18)23-17(28)12-32-21-24-25-26-27(21)13-7-3-2-4-8-13/h2-11H,12H2,1H3,(H,23,28) |
| InChIKey | KQJLQNLYMPIFHI-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.98 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|