C18H19ClN2O3S2 — CID 56524891
methyl 4-(2-chlorophenyl)-2-[(2-thiomorpholin-4-ylacetyl)amino]thiophene-3-carboxylate (PubChem CID 56524891) has the molecular formula C18H19ClN2O3S2 and a molecular weight of 410.95 g/mol. Its IUPAC name is methyl 4-(2-chlorophenyl)-2-[(2-thiomorpholin-4-ylacetyl)amino]thiophene-3-carboxylate.
| Compound Name | methyl 4-(2-chlorophenyl)-2-[(2-thiomorpholin-4-ylacetyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 56524891 |
| Molecular Formula | C18H19ClN2O3S2 |
| Molecular Weight | 410.95 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | methyl 4-(2-chlorophenyl)-2-[(2-thiomorpholin-4-ylacetyl)amino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccccc2Cl)csc1NC(=O)CN1CCSCC1 |
| InChI | InChI=1S/C18H19ClN2O3S2/c1-24-18(23)16-13(12-4-2-3-5-14(12)19)11-26-17(16)20-15(22)10-21-6-8-25-9-7-21/h2-5,11H,6-10H2,1H3,(H,20,22) |
| InChIKey | ZENVUTXSCKGPKQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.95 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|