C24H25ClN4O3S — CID 46667415
methyl 4-(2-chlorophenyl)-2-[[2-[4-(pyridin-2-ylmethyl)piperazin-1-yl]acetyl]amino]thiophene-3-carboxylate (PubChem CID 46667415) has the molecular formula C24H25ClN4O3S and a molecular weight of 485.01 g/mol. Its IUPAC name is methyl 4-(2-chlorophenyl)-2-[[2-[4-(pyridin-2-ylmethyl)piperazin-1-yl]acetyl]amino]thiophene-3-carboxylate.
| Compound Name | methyl 4-(2-chlorophenyl)-2-[[2-[4-(pyridin-2-ylmethyl)piperazin-1-yl]acetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 46667415 |
| Molecular Formula | C24H25ClN4O3S |
| Molecular Weight | 485.01 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | methyl 4-(2-chlorophenyl)-2-[[2-[4-(pyridin-2-ylmethyl)piperazin-1-yl]acetyl]amino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccccc2Cl)csc1NC(=O)CN1CCN(Cc2ccccn2)CC1 |
| InChI | InChI=1S/C24H25ClN4O3S/c1-32-24(31)22-19(18-7-2-3-8-20(18)25)16-33-23(22)27-21(30)15-29-12-10-28(11-13-29)14-17-6-4-5-9-26-17/h2-9,16H,10-15H2,1H3,(H,27,30) |
| InChIKey | GXVZHORTLYQJDM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.01 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|