C26H28FN3O3S — CID 22195906
methyl 2-[[2-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]acetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate (PubChem CID 22195906) has the molecular formula C26H28FN3O3S and a molecular weight of 481.59 g/mol. Its IUPAC name is methyl 2-[[2-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]acetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]acetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 22195906 |
| Molecular Formula | C26H28FN3O3S |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | methyl 2-[[2-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]acetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(C)cc2)csc1NC(=O)CN1CCN(Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C26H28FN3O3S/c1-18-3-7-20(8-4-18)22-17-34-25(24(22)26(32)33-2)28-23(31)16-30-13-11-29(12-14-30)15-19-5-9-21(27)10-6-19/h3-10,17H,11-16H2,1-2H3,(H,28,31) |
| InChIKey | IWDWKQFANIGQNQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|