C32H33N3O3S — CID 22198293
methyl 2-[[2-(4-benzhydrylpiperazin-1-yl)acetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate (PubChem CID 22198293) has the molecular formula C32H33N3O3S and a molecular weight of 539.70 g/mol. Its IUPAC name is methyl 2-[[2-(4-benzhydrylpiperazin-1-yl)acetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-(4-benzhydrylpiperazin-1-yl)acetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 22198293 |
| Molecular Formula | C32H33N3O3S |
| Molecular Weight | 539.70 g/mol |
| Exact Mass | 539.22 |
| IUPAC Name | methyl 2-[[2-(4-benzhydrylpiperazin-1-yl)acetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(C)cc2)csc1NC(=O)CN1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C32H33N3O3S/c1-23-13-15-24(16-14-23)27-22-39-31(29(27)32(37)38-2)33-28(36)21-34-17-19-35(20-18-34)30(25-9-5-3-6-10-25)26-11-7-4-8-12-26/h3-16,22,30H,17-21H2,1-2H3,(H,33,36) |
| InChIKey | WKHZDZGCMQXEPI-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.70 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|