C25H26FN3O4S — CID 22199108
methyl 2-[[2-[4-(2-fluorophenyl)piperazin-1-yl]acetyl]amino]-4-(4-methoxyphenyl)thiophene-3-carboxylate (PubChem CID 22199108) has the molecular formula C25H26FN3O4S and a molecular weight of 483.57 g/mol. Its IUPAC name is methyl 2-[[2-[4-(2-fluorophenyl)piperazin-1-yl]acetyl]amino]-4-(4-methoxyphenyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[4-(2-fluorophenyl)piperazin-1-yl]acetyl]amino]-4-(4-methoxyphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 22199108 |
| Molecular Formula | C25H26FN3O4S |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | methyl 2-[[2-[4-(2-fluorophenyl)piperazin-1-yl]acetyl]amino]-4-(4-methoxyphenyl)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(OC)cc2)csc1NC(=O)CN1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C25H26FN3O4S/c1-32-18-9-7-17(8-10-18)19-16-34-24(23(19)25(31)33-2)27-22(30)15-28-11-13-29(14-12-28)21-6-4-3-5-20(21)26/h3-10,16H,11-15H2,1-2H3,(H,27,30) |
| InChIKey | ATWDYTWRRXZYGO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|