C24H23ClFN3O3S — CID 22198674
methyl 2-[[2-[4-(3-chlorophenyl)piperazin-1-yl]acetyl]amino]-4-(4-fluorophenyl)thiophene-3-carboxylate (PubChem CID 22198674) has the molecular formula C24H23ClFN3O3S and a molecular weight of 487.98 g/mol. Its IUPAC name is methyl 2-[[2-[4-(3-chlorophenyl)piperazin-1-yl]acetyl]amino]-4-(4-fluorophenyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[4-(3-chlorophenyl)piperazin-1-yl]acetyl]amino]-4-(4-fluorophenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 22198674 |
| Molecular Formula | C24H23ClFN3O3S |
| Molecular Weight | 487.98 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | methyl 2-[[2-[4-(3-chlorophenyl)piperazin-1-yl]acetyl]amino]-4-(4-fluorophenyl)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(F)cc2)csc1NC(=O)CN1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C24H23ClFN3O3S/c1-32-24(31)22-20(16-5-7-18(26)8-6-16)15-33-23(22)27-21(30)14-28-9-11-29(12-10-28)19-4-2-3-17(25)13-19/h2-8,13,15H,9-12,14H2,1H3,(H,27,30) |
| InChIKey | MTRXJECNCQCIBT-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.98 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|