C25H26ClN3O4S — CID 22198626
methyl 4-(4-chlorophenyl)-2-[[2-[4-(4-methoxyphenyl)piperazin-1-yl]acetyl]amino]thiophene-3-carboxylate (PubChem CID 22198626) has the molecular formula C25H26ClN3O4S and a molecular weight of 500.02 g/mol. Its IUPAC name is methyl 4-(4-chlorophenyl)-2-[[2-[4-(4-methoxyphenyl)piperazin-1-yl]acetyl]amino]thiophene-3-carboxylate.
| Compound Name | methyl 4-(4-chlorophenyl)-2-[[2-[4-(4-methoxyphenyl)piperazin-1-yl]acetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 22198626 |
| Molecular Formula | C25H26ClN3O4S |
| Molecular Weight | 500.02 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | methyl 4-(4-chlorophenyl)-2-[[2-[4-(4-methoxyphenyl)piperazin-1-yl]acetyl]amino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(Cl)cc2)csc1NC(=O)CN1CCN(c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C25H26ClN3O4S/c1-32-20-9-7-19(8-10-20)29-13-11-28(12-14-29)15-22(30)27-24-23(25(31)33-2)21(16-34-24)17-3-5-18(26)6-4-17/h3-10,16H,11-15H2,1-2H3,(H,27,30) |
| InChIKey | YHRPNVRHWQIHHQ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.02 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|