C27H28FN3O3S — CID 6278450
methyl 4-(4-fluorophenyl)-2-[[2-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]acetyl]amino]thiophene-3-carboxylate (PubChem CID 6278450) has the molecular formula C27H28FN3O3S and a molecular weight of 493.60 g/mol. Its IUPAC name is methyl 4-(4-fluorophenyl)-2-[[2-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]acetyl]amino]thiophene-3-carboxylate.
| Compound Name | methyl 4-(4-fluorophenyl)-2-[[2-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]acetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 6278450 |
| Molecular Formula | C27H28FN3O3S |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | methyl 4-(4-fluorophenyl)-2-[[2-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]acetyl]amino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(F)cc2)csc1NC(=O)CN1CCN(C/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C27H28FN3O3S/c1-34-27(33)25-23(21-9-11-22(28)12-10-21)19-35-26(25)29-24(32)18-31-16-14-30(15-17-31)13-5-8-20-6-3-2-4-7-20/h2-12,19H,13-18H2,1H3,(H,29,32)/b8-5+ |
| InChIKey | JKDDQMQFNDVYLA-VMPITWQZSA-N |
| XLogP | 4.61 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|