C20H23FN2O4S — CID 27524291
methyl 2-[[2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]acetyl]amino]-4-(4-fluorophenyl)thiophene-3-carboxylate (PubChem CID 27524291) has the molecular formula C20H23FN2O4S and a molecular weight of 406.48 g/mol. Its IUPAC name is methyl 2-[[2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]acetyl]amino]-4-(4-fluorophenyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]acetyl]amino]-4-(4-fluorophenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 27524291 |
| Molecular Formula | C20H23FN2O4S |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | methyl 2-[[2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]acetyl]amino]-4-(4-fluorophenyl)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(F)cc2)csc1NC(=O)CN1C[C@@H](C)O[C@H](C)C1 |
| InChI | InChI=1S/C20H23FN2O4S/c1-12-8-23(9-13(2)27-12)10-17(24)22-19-18(20(25)26-3)16(11-28-19)14-4-6-15(21)7-5-14/h4-7,11-13H,8-10H2,1-3H3,(H,22,24)/t12-,13-/m1/s1 |
| InChIKey | OAPSLAYULSKYOI-CHWSQXEVSA-N |
| XLogP | 3.39 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|