C23H30N2O4S — CID 28985089
ethyl 2-[3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate (PubChem CID 28985089) has the molecular formula C23H30N2O4S and a molecular weight of 430.57 g/mol. Its IUPAC name is ethyl 2-[3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 28985089 |
| Molecular Formula | C23H30N2O4S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | ethyl 2-[3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(C)cc2)csc1NC(=O)CCN1C[C@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C23H30N2O4S/c1-5-28-23(27)21-19(18-8-6-15(2)7-9-18)14-30-22(21)24-20(26)10-11-25-12-16(3)29-17(4)13-25/h6-9,14,16-17H,5,10-13H2,1-4H3,(H,24,26)/t16-,17-/m0/s1 |
| InChIKey | MHDXUMMTFHBYOU-IRXDYDNUSA-N |
| XLogP | 4.34 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|