C23H22FNO3S — CID 19220566
ethyl 4-(4-fluorophenyl)-2-[3-(4-methylphenyl)propanoylamino]thiophene-3-carboxylate (PubChem CID 19220566) has the molecular formula C23H22FNO3S and a molecular weight of 411.50 g/mol. Its IUPAC name is ethyl 4-(4-fluorophenyl)-2-[3-(4-methylphenyl)propanoylamino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-(4-fluorophenyl)-2-[3-(4-methylphenyl)propanoylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19220566 |
| Molecular Formula | C23H22FNO3S |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | ethyl 4-(4-fluorophenyl)-2-[3-(4-methylphenyl)propanoylamino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(F)cc2)csc1NC(=O)CCc1ccc(C)cc1 |
| InChI | InChI=1S/C23H22FNO3S/c1-3-28-23(27)21-19(17-9-11-18(24)12-10-17)14-29-22(21)25-20(26)13-8-16-6-4-15(2)5-7-16/h4-7,9-12,14H,3,8,13H2,1-2H3,(H,25,26) |
| InChIKey | LWMZNCVNYVTIJR-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|