C20H15ClFNO3S — CID 25227060
4-(4-chlorophenyl)-2-[3-(4-fluorophenyl)propanoylamino]thiophene-3-carboxylic acid (PubChem CID 25227060) has the molecular formula C20H15ClFNO3S and a molecular weight of 403.86 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-[3-(4-fluorophenyl)propanoylamino]thiophene-3-carboxylic acid.
| Compound Name | 4-(4-chlorophenyl)-2-[3-(4-fluorophenyl)propanoylamino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 25227060 |
| Molecular Formula | C20H15ClFNO3S |
| Molecular Weight | 403.86 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | 4-(4-chlorophenyl)-2-[3-(4-fluorophenyl)propanoylamino]thiophene-3-carboxylic acid |
| SMILES | O=C(CCc1ccc(F)cc1)Nc1scc(-c2ccc(Cl)cc2)c1C(=O)O |
| InChI | InChI=1S/C20H15ClFNO3S/c21-14-6-4-13(5-7-14)16-11-27-19(18(16)20(25)26)23-17(24)10-3-12-1-8-15(22)9-2-12/h1-2,4-9,11H,3,10H2,(H,23,24)(H,25,26) |
| InChIKey | FPUHHWYMUBTYKQ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.86 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|