C16H16ClNO3S — CID 913955
4-(4-chlorophenyl)-2-(2,2-dimethylpropanoylamino)thiophene-3-carboxylic acid (PubChem CID 913955) has the molecular formula C16H16ClNO3S and a molecular weight of 337.83 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-(2,2-dimethylpropanoylamino)thiophene-3-carboxylic acid.
| Compound Name | 4-(4-chlorophenyl)-2-(2,2-dimethylpropanoylamino)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 913955 |
| Molecular Formula | C16H16ClNO3S |
| Molecular Weight | 337.83 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | 4-(4-chlorophenyl)-2-(2,2-dimethylpropanoylamino)thiophene-3-carboxylic acid |
| SMILES | CC(C)(C)C(=O)Nc1scc(-c2ccc(Cl)cc2)c1C(=O)O |
| InChI | InChI=1S/C16H16ClNO3S/c1-16(2,3)15(21)18-13-12(14(19)20)11(8-22-13)9-4-6-10(17)7-5-9/h4-8H,1-3H3,(H,18,21)(H,19,20) |
| InChIKey | SSIDBIZRNIVVFQ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.83 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|