C17H9ClF3N3O3S — CID 67225295
4-(4-chlorophenyl)-2-[[2-(trifluoromethyl)pyrimidine-5-carbonyl]amino]thiophene-3-carboxylic acid (PubChem CID 67225295) has the molecular formula C17H9ClF3N3O3S and a molecular weight of 427.79 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-[[2-(trifluoromethyl)pyrimidine-5-carbonyl]amino]thiophene-3-carboxylic acid.
| Compound Name | 4-(4-chlorophenyl)-2-[[2-(trifluoromethyl)pyrimidine-5-carbonyl]amino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 67225295 |
| Molecular Formula | C17H9ClF3N3O3S |
| Molecular Weight | 427.79 g/mol |
| Exact Mass | 427.00 |
| IUPAC Name | 4-(4-chlorophenyl)-2-[[2-(trifluoromethyl)pyrimidine-5-carbonyl]amino]thiophene-3-carboxylic acid |
| SMILES | O=C(Nc1scc(-c2ccc(Cl)cc2)c1C(=O)O)c1cnc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C17H9ClF3N3O3S/c18-10-3-1-8(2-4-10)11-7-28-14(12(11)15(26)27)24-13(25)9-5-22-16(23-6-9)17(19,20)21/h1-7H,(H,24,25)(H,26,27) |
| InChIKey | KOAZJTCRGJUHPH-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.79 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|