C18H10ClN3O3S2 — CID 67052275
2-(2,1,3-benzothiadiazole-4-carbonylamino)-4-(4-chlorophenyl)thiophene-3-carboxylic acid (PubChem CID 67052275) has the molecular formula C18H10ClN3O3S2 and a molecular weight of 415.88 g/mol. Its IUPAC name is 2-(2,1,3-benzothiadiazole-4-carbonylamino)-4-(4-chlorophenyl)thiophene-3-carboxylic acid.
| Compound Name | 2-(2,1,3-benzothiadiazole-4-carbonylamino)-4-(4-chlorophenyl)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 67052275 |
| Molecular Formula | C18H10ClN3O3S2 |
| Molecular Weight | 415.88 g/mol |
| Exact Mass | 414.99 |
| IUPAC Name | 2-(2,1,3-benzothiadiazole-4-carbonylamino)-4-(4-chlorophenyl)thiophene-3-carboxylic acid |
| SMILES | O=C(O)c1c(-c2ccc(Cl)cc2)csc1NC(=O)c1cccc2nsnc12 |
| InChI | InChI=1S/C18H10ClN3O3S2/c19-10-6-4-9(5-7-10)12-8-26-17(14(12)18(24)25)20-16(23)11-2-1-3-13-15(11)22-27-21-13/h1-8H,(H,20,23)(H,24,25) |
| InChIKey | YAJCHEXJTQXBHJ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.88 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|