C20H14Cl2FNO3S — CID 58295629
4-(4-chlorophenyl)-2-[[(2S)-3-(2-chlorophenyl)-2-fluoropropanoyl]amino]thiophene-3-carboxylic acid (PubChem CID 58295629) has the molecular formula C20H14Cl2FNO3S and a molecular weight of 438.31 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-[[(2S)-3-(2-chlorophenyl)-2-fluoropropanoyl]amino]thiophene-3-carboxylic acid.
| Compound Name | 4-(4-chlorophenyl)-2-[[(2S)-3-(2-chlorophenyl)-2-fluoropropanoyl]amino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 58295629 |
| Molecular Formula | C20H14Cl2FNO3S |
| Molecular Weight | 438.31 g/mol |
| Exact Mass | 437.01 |
| IUPAC Name | 4-(4-chlorophenyl)-2-[[(2S)-3-(2-chlorophenyl)-2-fluoropropanoyl]amino]thiophene-3-carboxylic acid |
| SMILES | O=C(O)c1c(-c2ccc(Cl)cc2)csc1NC(=O)[C@@H](F)Cc1ccccc1Cl |
| InChI | InChI=1S/C20H14Cl2FNO3S/c21-13-7-5-11(6-8-13)14-10-28-19(17(14)20(26)27)24-18(25)16(23)9-12-3-1-2-4-15(12)22/h1-8,10,16H,9H2,(H,24,25)(H,26,27)/t16-/m0/s1 |
| InChIKey | ROGZWRXTDBUDSA-INIZCTEOSA-N |
| XLogP | 5.94 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.31 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|