C21H18ClNO3S — CID 58295534
4-(4-chlorophenyl)-2-(4-phenylbutanoylamino)thiophene-3-carboxylic acid (PubChem CID 58295534) has the molecular formula C21H18ClNO3S and a molecular weight of 399.90 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-(4-phenylbutanoylamino)thiophene-3-carboxylic acid.
| Compound Name | 4-(4-chlorophenyl)-2-(4-phenylbutanoylamino)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 58295534 |
| Molecular Formula | C21H18ClNO3S |
| Molecular Weight | 399.90 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | 4-(4-chlorophenyl)-2-(4-phenylbutanoylamino)thiophene-3-carboxylic acid |
| SMILES | O=C(CCCc1ccccc1)Nc1scc(-c2ccc(Cl)cc2)c1C(=O)O |
| InChI | InChI=1S/C21H18ClNO3S/c22-16-11-9-15(10-12-16)17-13-27-20(19(17)21(25)26)23-18(24)8-4-7-14-5-2-1-3-6-14/h1-3,5-6,9-13H,4,7-8H2,(H,23,24)(H,25,26) |
| InChIKey | GQRGUJXZIVBHGT-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.90 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|