C20H13ClFNO3S — CID 59536060
4-(4-chlorophenyl)-2-[[(E)-3-(2-fluorophenyl)prop-2-enoyl]amino]thiophene-3-carboxylic acid (PubChem CID 59536060) has the molecular formula C20H13ClFNO3S and a molecular weight of 401.85 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-[[(E)-3-(2-fluorophenyl)prop-2-enoyl]amino]thiophene-3-carboxylic acid.
| Compound Name | 4-(4-chlorophenyl)-2-[[(E)-3-(2-fluorophenyl)prop-2-enoyl]amino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 59536060 |
| Molecular Formula | C20H13ClFNO3S |
| Molecular Weight | 401.85 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | 4-(4-chlorophenyl)-2-[[(E)-3-(2-fluorophenyl)prop-2-enoyl]amino]thiophene-3-carboxylic acid |
| SMILES | O=C(/C=C/c1ccccc1F)Nc1scc(-c2ccc(Cl)cc2)c1C(=O)O |
| InChI | InChI=1S/C20H13ClFNO3S/c21-14-8-5-12(6-9-14)15-11-27-19(18(15)20(25)26)23-17(24)10-7-13-3-1-2-4-16(13)22/h1-11H,(H,23,24)(H,25,26)/b10-7+ |
| InChIKey | MCUQQFBKWIWVNI-JXMROGBWSA-N |
| XLogP | 5.56 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.85 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|