C19H13Cl2NO2S — CID 89177651
4-(4-chlorophenyl)-2-[1-(2-chlorophenyl)ethenylamino]thiophene-3-carboxylic acid (PubChem CID 89177651) has the molecular formula C19H13Cl2NO2S and a molecular weight of 390.29 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-[1-(2-chlorophenyl)ethenylamino]thiophene-3-carboxylic acid.
| Compound Name | 4-(4-chlorophenyl)-2-[1-(2-chlorophenyl)ethenylamino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 89177651 |
| Molecular Formula | C19H13Cl2NO2S |
| Molecular Weight | 390.29 g/mol |
| Exact Mass | 389.00 |
| IUPAC Name | 4-(4-chlorophenyl)-2-[1-(2-chlorophenyl)ethenylamino]thiophene-3-carboxylic acid |
| SMILES | C=C(Nc1scc(-c2ccc(Cl)cc2)c1C(=O)O)c1ccccc1Cl |
| InChI | InChI=1S/C19H13Cl2NO2S/c1-11(14-4-2-3-5-16(14)21)22-18-17(19(23)24)15(10-25-18)12-6-8-13(20)9-7-12/h2-10,22H,1H2,(H,23,24) |
| InChIKey | PLOBEUWKWSSTCG-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.29 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |