C24H15ClNO3S- — CID 2323012
2-[(2-chlorobenzoyl)amino]-4-(4-phenylphenyl)thiophene-3-carboxylate (PubChem CID 2323012) has the molecular formula C24H15ClNO3S- and a molecular weight of 432.91 g/mol. Its IUPAC name is 2-[(2-chlorobenzoyl)amino]-4-(4-phenylphenyl)thiophene-3-carboxylate.
| Compound Name | 2-[(2-chlorobenzoyl)amino]-4-(4-phenylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 2323012 |
| Molecular Formula | C24H15ClNO3S- |
| Molecular Weight | 432.91 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | 2-[(2-chlorobenzoyl)amino]-4-(4-phenylphenyl)thiophene-3-carboxylate |
| SMILES | O=C(Nc1scc(-c2ccc(-c3ccccc3)cc2)c1C(=O)[O-])c1ccccc1Cl |
| InChI | InChI=1S/C24H16ClNO3S/c25-20-9-5-4-8-18(20)22(27)26-23-21(24(28)29)19(14-30-23)17-12-10-16(11-13-17)15-6-2-1-3-7-15/h1-14H,(H,26,27)(H,28,29)/p-1 |
| InChIKey | CEGLQUNFDWQLEQ-UHFFFAOYSA-M |
| XLogP | 5.35 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.91 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|