C18H12ClNO3S — CID 139391684
2-benzamido-4-(3-chlorophenyl)thiophene-3-carboxylic acid (PubChem CID 139391684) has the molecular formula C18H12ClNO3S and a molecular weight of 357.82 g/mol. Its IUPAC name is 2-benzamido-4-(3-chlorophenyl)thiophene-3-carboxylic acid.
| Compound Name | 2-benzamido-4-(3-chlorophenyl)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 139391684 |
| Molecular Formula | C18H12ClNO3S |
| Molecular Weight | 357.82 g/mol |
| Exact Mass | 357.02 |
| IUPAC Name | 2-benzamido-4-(3-chlorophenyl)thiophene-3-carboxylic acid |
| SMILES | O=C(Nc1scc(-c2cccc(Cl)c2)c1C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C18H12ClNO3S/c19-13-8-4-7-12(9-13)14-10-24-17(15(14)18(22)23)20-16(21)11-5-2-1-3-6-11/h1-10H,(H,20,21)(H,22,23) |
| InChIKey | AAMISAJVAYCSSF-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.82 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|