C18H10Cl2FNO3S — CID 25225581
4-(2,4-dichlorophenyl)-2-[(3-fluorobenzoyl)amino]thiophene-3-carboxylic acid (PubChem CID 25225581) has the molecular formula C18H10Cl2FNO3S and a molecular weight of 410.25 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-2-[(3-fluorobenzoyl)amino]thiophene-3-carboxylic acid.
| Compound Name | 4-(2,4-dichlorophenyl)-2-[(3-fluorobenzoyl)amino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 25225581 |
| Molecular Formula | C18H10Cl2FNO3S |
| Molecular Weight | 410.25 g/mol |
| Exact Mass | 408.97 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-2-[(3-fluorobenzoyl)amino]thiophene-3-carboxylic acid |
| SMILES | O=C(Nc1scc(-c2ccc(Cl)cc2Cl)c1C(=O)O)c1cccc(F)c1 |
| InChI | InChI=1S/C18H10Cl2FNO3S/c19-10-4-5-12(14(20)7-10)13-8-26-17(15(13)18(24)25)22-16(23)9-2-1-3-11(21)6-9/h1-8H,(H,22,23)(H,24,25) |
| InChIKey | SNQDCURCBCFYFO-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.25 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|