C19H14FNO3S — CID 25225584
2-[(3-fluorobenzoyl)amino]-4-(4-methylphenyl)thiophene-3-carboxylic acid (PubChem CID 25225584) has the molecular formula C19H14FNO3S and a molecular weight of 355.39 g/mol. Its IUPAC name is 2-[(3-fluorobenzoyl)amino]-4-(4-methylphenyl)thiophene-3-carboxylic acid.
| Compound Name | 2-[(3-fluorobenzoyl)amino]-4-(4-methylphenyl)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 25225584 |
| Molecular Formula | C19H14FNO3S |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | 2-[(3-fluorobenzoyl)amino]-4-(4-methylphenyl)thiophene-3-carboxylic acid |
| SMILES | Cc1ccc(-c2csc(NC(=O)c3cccc(F)c3)c2C(=O)O)cc1 |
| InChI | InChI=1S/C19H14FNO3S/c1-11-5-7-12(8-6-11)15-10-25-18(16(15)19(23)24)21-17(22)13-3-2-4-14(20)9-13/h2-10H,1H3,(H,21,22)(H,23,24) |
| InChIKey | RQGJBOGLIDKSLE-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|