C20H14F3NO3S — CID 25226135
2-[(3-methylbenzoyl)amino]-4-[4-(trifluoromethyl)phenyl]thiophene-3-carboxylic acid (PubChem CID 25226135) has the molecular formula C20H14F3NO3S and a molecular weight of 405.40 g/mol. Its IUPAC name is 2-[(3-methylbenzoyl)amino]-4-[4-(trifluoromethyl)phenyl]thiophene-3-carboxylic acid.
| Compound Name | 2-[(3-methylbenzoyl)amino]-4-[4-(trifluoromethyl)phenyl]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 25226135 |
| Molecular Formula | C20H14F3NO3S |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | 2-[(3-methylbenzoyl)amino]-4-[4-(trifluoromethyl)phenyl]thiophene-3-carboxylic acid |
| SMILES | Cc1cccc(C(=O)Nc2scc(-c3ccc(C(F)(F)F)cc3)c2C(=O)O)c1 |
| InChI | InChI=1S/C20H14F3NO3S/c1-11-3-2-4-13(9-11)17(25)24-18-16(19(26)27)15(10-28-18)12-5-7-14(8-6-12)20(21,22)23/h2-10H,1H3,(H,24,25)(H,26,27) |
| InChIKey | LWUNRVPXCBAAPY-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|