C21H12F3NO3S2 — CID 25227242
2-(1-benzothiophene-2-carbonylamino)-4-[4-(trifluoromethyl)phenyl]thiophene-3-carboxylic acid (PubChem CID 25227242) has the molecular formula C21H12F3NO3S2 and a molecular weight of 447.46 g/mol. Its IUPAC name is 2-(1-benzothiophene-2-carbonylamino)-4-[4-(trifluoromethyl)phenyl]thiophene-3-carboxylic acid.
| Compound Name | 2-(1-benzothiophene-2-carbonylamino)-4-[4-(trifluoromethyl)phenyl]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 25227242 |
| Molecular Formula | C21H12F3NO3S2 |
| Molecular Weight | 447.46 g/mol |
| Exact Mass | 447.02 |
| IUPAC Name | 2-(1-benzothiophene-2-carbonylamino)-4-[4-(trifluoromethyl)phenyl]thiophene-3-carboxylic acid |
| SMILES | O=C(Nc1scc(-c2ccc(C(F)(F)F)cc2)c1C(=O)O)c1cc2ccccc2s1 |
| InChI | InChI=1S/C21H12F3NO3S2/c22-21(23,24)13-7-5-11(6-8-13)14-10-29-19(17(14)20(27)28)25-18(26)16-9-12-3-1-2-4-15(12)30-16/h1-10H,(H,25,26)(H,27,28) |
| InChIKey | ANRXTAWUWNHEMX-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.46 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|