C18H12FNO3S — CID 829695
2-[(4-fluorobenzoyl)amino]-4-phenylthiophene-3-carboxylic acid (PubChem CID 829695) has the molecular formula C18H12FNO3S and a molecular weight of 341.36 g/mol. Its IUPAC name is 2-[(4-fluorobenzoyl)amino]-4-phenylthiophene-3-carboxylic acid.
| Compound Name | 2-[(4-fluorobenzoyl)amino]-4-phenylthiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 829695 |
| Molecular Formula | C18H12FNO3S |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 2-[(4-fluorobenzoyl)amino]-4-phenylthiophene-3-carboxylic acid |
| SMILES | O=C(Nc1scc(-c2ccccc2)c1C(=O)O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H12FNO3S/c19-13-8-6-12(7-9-13)16(21)20-17-15(18(22)23)14(10-24-17)11-4-2-1-3-5-11/h1-10H,(H,20,21)(H,22,23) |
| InChIKey | DRGPXTMDFBWKEG-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|