C20H17NO3S — CID 1037842
2-[(3-methylbenzoyl)amino]-4-(4-methylphenyl)thiophene-3-carboxylic acid (PubChem CID 1037842) has the molecular formula C20H17NO3S and a molecular weight of 351.43 g/mol. Its IUPAC name is 2-[(3-methylbenzoyl)amino]-4-(4-methylphenyl)thiophene-3-carboxylic acid.
| Compound Name | 2-[(3-methylbenzoyl)amino]-4-(4-methylphenyl)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 1037842 |
| Molecular Formula | C20H17NO3S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 2-[(3-methylbenzoyl)amino]-4-(4-methylphenyl)thiophene-3-carboxylic acid |
| SMILES | Cc1ccc(-c2csc(NC(=O)c3cccc(C)c3)c2C(=O)O)cc1 |
| InChI | InChI=1S/C20H17NO3S/c1-12-6-8-14(9-7-12)16-11-25-19(17(16)20(23)24)21-18(22)15-5-3-4-13(2)10-15/h3-11H,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | IFUQFGLMSDXWSZ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|