C20H19FN2O4S — CID 143950072
ethane;2-[(3-fluorobenzoyl)amino]-4-(6-methoxy-3-pyridinyl)thiophene-3-carboxylic acid (PubChem CID 143950072) has the molecular formula C20H19FN2O4S and a molecular weight of 402.45 g/mol. Its IUPAC name is ethane;2-[(3-fluorobenzoyl)amino]-4-(6-methoxy-3-pyridinyl)thiophene-3-carboxylic acid.
| Compound Name | ethane;2-[(3-fluorobenzoyl)amino]-4-(6-methoxy-3-pyridinyl)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 143950072 |
| Molecular Formula | C20H19FN2O4S |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | ethane;2-[(3-fluorobenzoyl)amino]-4-(6-methoxy-3-pyridinyl)thiophene-3-carboxylic acid |
| SMILES | CC.COc1ccc(-c2csc(NC(=O)c3cccc(F)c3)c2C(=O)O)cn1 |
| InChI | InChI=1S/C18H13FN2O4S.C2H6/c1-25-14-6-5-11(8-20-14)13-9-26-17(15(13)18(23)24)21-16(22)10-3-2-4-12(19)7-10;1-2/h2-9H,1H3,(H,21,22)(H,23,24);1-2H3 |
| InChIKey | BQRYQCLMFHHVIS-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |