C19H14BrNO4S — CID 89458111
4-(4-bromophenyl)-2-[(2-hydroxy-5-methylbenzoyl)amino]thiophene-3-carboxylic acid (PubChem CID 89458111) has the molecular formula C19H14BrNO4S and a molecular weight of 432.30 g/mol. Its IUPAC name is 4-(4-bromophenyl)-2-[(2-hydroxy-5-methylbenzoyl)amino]thiophene-3-carboxylic acid.
| Compound Name | 4-(4-bromophenyl)-2-[(2-hydroxy-5-methylbenzoyl)amino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 89458111 |
| Molecular Formula | C19H14BrNO4S |
| Molecular Weight | 432.30 g/mol |
| Exact Mass | 430.98 |
| IUPAC Name | 4-(4-bromophenyl)-2-[(2-hydroxy-5-methylbenzoyl)amino]thiophene-3-carboxylic acid |
| SMILES | Cc1ccc(O)c(C(=O)Nc2scc(-c3ccc(Br)cc3)c2C(=O)O)c1 |
| InChI | InChI=1S/C19H14BrNO4S/c1-10-2-7-15(22)13(8-10)17(23)21-18-16(19(24)25)14(9-26-18)11-3-5-12(20)6-4-11/h2-9,22H,1H3,(H,21,23)(H,24,25) |
| InChIKey | BFABKZSTZLFRBR-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.30 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|