C17H19NO3S — CID 28859727
4-(4-methylphenyl)-2-(pentanoylamino)thiophene-3-carboxylic acid (PubChem CID 28859727) has the molecular formula C17H19NO3S and a molecular weight of 317.41 g/mol. Its IUPAC name is 4-(4-methylphenyl)-2-(pentanoylamino)thiophene-3-carboxylic acid.
| Compound Name | 4-(4-methylphenyl)-2-(pentanoylamino)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 28859727 |
| Molecular Formula | C17H19NO3S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 4-(4-methylphenyl)-2-(pentanoylamino)thiophene-3-carboxylic acid |
| SMILES | CCCCC(=O)Nc1scc(-c2ccc(C)cc2)c1C(=O)O |
| InChI | InChI=1S/C17H19NO3S/c1-3-4-5-14(19)18-16-15(17(20)21)13(10-22-16)12-8-6-11(2)7-9-12/h6-10H,3-5H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | DCSQFMNCZSHSEQ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|