C23H23NO3S — CID 143954326
4-(4-methylphenyl)-2-[(3-methyl-3-phenylbutanoyl)amino]thiophene-3-carboxylic acid (PubChem CID 143954326) has the molecular formula C23H23NO3S and a molecular weight of 393.51 g/mol. Its IUPAC name is 4-(4-methylphenyl)-2-[(3-methyl-3-phenylbutanoyl)amino]thiophene-3-carboxylic acid.
| Compound Name | 4-(4-methylphenyl)-2-[(3-methyl-3-phenylbutanoyl)amino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 143954326 |
| Molecular Formula | C23H23NO3S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 4-(4-methylphenyl)-2-[(3-methyl-3-phenylbutanoyl)amino]thiophene-3-carboxylic acid |
| SMILES | Cc1ccc(-c2csc(NC(=O)CC(C)(C)c3ccccc3)c2C(=O)O)cc1 |
| InChI | InChI=1S/C23H23NO3S/c1-15-9-11-16(12-10-15)18-14-28-21(20(18)22(26)27)24-19(25)13-23(2,3)17-7-5-4-6-8-17/h4-12,14H,13H2,1-3H3,(H,24,25)(H,26,27) |
| InChIKey | DKQUCADDIOXGOD-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|