C21H19NO4S — CID 28859679
2-[[2-(2,3-dimethylphenoxy)acetyl]amino]-4-phenylthiophene-3-carboxylic acid (PubChem CID 28859679) has the molecular formula C21H19NO4S and a molecular weight of 381.45 g/mol. Its IUPAC name is 2-[[2-(2,3-dimethylphenoxy)acetyl]amino]-4-phenylthiophene-3-carboxylic acid.
| Compound Name | 2-[[2-(2,3-dimethylphenoxy)acetyl]amino]-4-phenylthiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 28859679 |
| Molecular Formula | C21H19NO4S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 2-[[2-(2,3-dimethylphenoxy)acetyl]amino]-4-phenylthiophene-3-carboxylic acid |
| SMILES | Cc1cccc(OCC(=O)Nc2scc(-c3ccccc3)c2C(=O)O)c1C |
| InChI | InChI=1S/C21H19NO4S/c1-13-7-6-10-17(14(13)2)26-11-18(23)22-20-19(21(24)25)16(12-27-20)15-8-4-3-5-9-15/h3-10,12H,11H2,1-2H3,(H,22,23)(H,24,25) |
| InChIKey | MAMXNRFFWYYKCV-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|