C21H17Cl2NO4S — CID 2382749
ethyl 2-[[2-(2,3-dichlorophenoxy)acetyl]amino]-4-phenylthiophene-3-carboxylate (PubChem CID 2382749) has the molecular formula C21H17Cl2NO4S and a molecular weight of 450.34 g/mol. Its IUPAC name is ethyl 2-[[2-(2,3-dichlorophenoxy)acetyl]amino]-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-(2,3-dichlorophenoxy)acetyl]amino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 2382749 |
| Molecular Formula | C21H17Cl2NO4S |
| Molecular Weight | 450.34 g/mol |
| Exact Mass | 449.03 |
| IUPAC Name | ethyl 2-[[2-(2,3-dichlorophenoxy)acetyl]amino]-4-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)COc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C21H17Cl2NO4S/c1-2-27-21(26)18-14(13-7-4-3-5-8-13)12-29-20(18)24-17(25)11-28-16-10-6-9-15(22)19(16)23/h3-10,12H,2,11H2,1H3,(H,24,25) |
| InChIKey | HVXXBCCMTUAAIE-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.34 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|