C22H19NO6S — CID 18275006
ethyl 2-[[2-(3-hydroxybenzoyl)oxyacetyl]amino]-4-phenylthiophene-3-carboxylate (PubChem CID 18275006) has the molecular formula C22H19NO6S and a molecular weight of 425.46 g/mol. Its IUPAC name is ethyl 2-[[2-(3-hydroxybenzoyl)oxyacetyl]amino]-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-(3-hydroxybenzoyl)oxyacetyl]amino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 18275006 |
| Molecular Formula | C22H19NO6S |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | ethyl 2-[[2-(3-hydroxybenzoyl)oxyacetyl]amino]-4-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)COC(=O)c1cccc(O)c1 |
| InChI | InChI=1S/C22H19NO6S/c1-2-28-22(27)19-17(14-7-4-3-5-8-14)13-30-20(19)23-18(25)12-29-21(26)15-9-6-10-16(24)11-15/h3-11,13,24H,2,12H2,1H3,(H,23,25) |
| InChIKey | RBCZXWDCMZZQMC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|