C21H21N2O3S+ — CID 8826819
ethyl 2-[[2-(2-methylpyridin-1-ium-1-yl)acetyl]amino]-4-phenylthiophene-3-carboxylate (PubChem CID 8826819) has the molecular formula C21H21N2O3S+ and a molecular weight of 381.48 g/mol. Its IUPAC name is ethyl 2-[[2-(2-methylpyridin-1-ium-1-yl)acetyl]amino]-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-(2-methylpyridin-1-ium-1-yl)acetyl]amino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 8826819 |
| Molecular Formula | C21H21N2O3S+ |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | ethyl 2-[[2-(2-methylpyridin-1-ium-1-yl)acetyl]amino]-4-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)C[n+]1ccccc1C |
| InChI | InChI=1S/C21H20N2O3S/c1-3-26-21(25)19-17(16-10-5-4-6-11-16)14-27-20(19)22-18(24)13-23-12-8-7-9-15(23)2/h4-12,14H,3,13H2,1-2H3/p+1 |
| InChIKey | BCYQBHKJVZZSRE-UHFFFAOYSA-O |
| XLogP | 3.83 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|