C24H21N2O3S+ — CID 8829202
ethyl 2-[(2-isoquinolin-2-ium-2-ylacetyl)amino]-4-phenylthiophene-3-carboxylate (PubChem CID 8829202) has the molecular formula C24H21N2O3S+ and a molecular weight of 417.51 g/mol. Its IUPAC name is ethyl 2-[(2-isoquinolin-2-ium-2-ylacetyl)amino]-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[(2-isoquinolin-2-ium-2-ylacetyl)amino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 8829202 |
| Molecular Formula | C24H21N2O3S+ |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | ethyl 2-[(2-isoquinolin-2-ium-2-ylacetyl)amino]-4-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)C[n+]1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H20N2O3S/c1-2-29-24(28)22-20(18-9-4-3-5-10-18)16-30-23(22)25-21(27)15-26-13-12-17-8-6-7-11-19(17)14-26/h3-14,16H,2,15H2,1H3/p+1 |
| InChIKey | UTRXSFOGLGUNFN-UHFFFAOYSA-O |
| XLogP | 4.67 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|