C28H30N2O7S2 — CID 23825496
ethyl 2-[[2-[3-(azepan-1-ylsulfonyl)benzoyl]oxyacetyl]amino]-4-phenylthiophene-3-carboxylate (PubChem CID 23825496) has the molecular formula C28H30N2O7S2 and a molecular weight of 570.69 g/mol. Its IUPAC name is ethyl 2-[[2-[3-(azepan-1-ylsulfonyl)benzoyl]oxyacetyl]amino]-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[3-(azepan-1-ylsulfonyl)benzoyl]oxyacetyl]amino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 23825496 |
| Molecular Formula | C28H30N2O7S2 |
| Molecular Weight | 570.69 g/mol |
| Exact Mass | 570.15 |
| IUPAC Name | ethyl 2-[[2-[3-(azepan-1-ylsulfonyl)benzoyl]oxyacetyl]amino]-4-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)COC(=O)c1cccc(S(=O)(=O)N2CCCCCC2)c1 |
| InChI | InChI=1S/C28H30N2O7S2/c1-2-36-28(33)25-23(20-11-6-5-7-12-20)19-38-26(25)29-24(31)18-37-27(32)21-13-10-14-22(17-21)39(34,35)30-15-8-3-4-9-16-30/h5-7,10-14,17,19H,2-4,8-9,15-16,18H2,1H3,(H,29,31) |
| InChIKey | IHYYMKLTSFQQHJ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.69 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|