C18H17N3O5S2 — CID 4853662
[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 3-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 4853662) has the molecular formula C18H17N3O5S2 and a molecular weight of 419.48 g/mol. Its IUPAC name is [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 3-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 3-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 4853662 |
| Molecular Formula | C18H17N3O5S2 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 3-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | N#Cc1ccsc1NC(=O)COC(=O)c1cccc(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C18H17N3O5S2/c19-11-14-6-9-27-17(14)20-16(22)12-26-18(23)13-4-3-5-15(10-13)28(24,25)21-7-1-2-8-21/h3-6,9-10H,1-2,7-8,12H2,(H,20,22) |
| InChIKey | GUQFENWWFAGPNB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |