C21H22Cl2N2O5S — CID 4802573
[2-(2,5-dichloroanilino)-2-oxoethyl] 3-(azepan-1-ylsulfonyl)benzoate (PubChem CID 4802573) has the molecular formula C21H22Cl2N2O5S and a molecular weight of 485.39 g/mol. Its IUPAC name is [2-(2,5-dichloroanilino)-2-oxoethyl] 3-(azepan-1-ylsulfonyl)benzoate.
| Compound Name | [2-(2,5-dichloroanilino)-2-oxoethyl] 3-(azepan-1-ylsulfonyl)benzoate |
|---|---|
| PubChem CID | 4802573 |
| Molecular Formula | C21H22Cl2N2O5S |
| Molecular Weight | 485.39 g/mol |
| Exact Mass | 484.06 |
| IUPAC Name | [2-(2,5-dichloroanilino)-2-oxoethyl] 3-(azepan-1-ylsulfonyl)benzoate |
| SMILES | O=C(COC(=O)c1cccc(S(=O)(=O)N2CCCCCC2)c1)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C21H22Cl2N2O5S/c22-16-8-9-18(23)19(13-16)24-20(26)14-30-21(27)15-6-5-7-17(12-15)31(28,29)25-10-3-1-2-4-11-25/h5-9,12-13H,1-4,10-11,14H2,(H,24,26) |
| InChIKey | FRWRDTXYXLFQPE-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.39 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |