C19H20ClN3O5S — CID 2510932
[2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 3-piperidin-1-ylsulfonylbenzoate (PubChem CID 2510932) has the molecular formula C19H20ClN3O5S and a molecular weight of 437.91 g/mol. Its IUPAC name is [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 3-piperidin-1-ylsulfonylbenzoate.
| Compound Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 3-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2510932 |
| Molecular Formula | C19H20ClN3O5S |
| Molecular Weight | 437.91 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 3-piperidin-1-ylsulfonylbenzoate |
| SMILES | O=C(COC(=O)c1cccc(S(=O)(=O)N2CCCCC2)c1)Nc1cccnc1Cl |
| InChI | InChI=1S/C19H20ClN3O5S/c20-18-16(8-5-9-21-18)22-17(24)13-28-19(25)14-6-4-7-15(12-14)29(26,27)23-10-2-1-3-11-23/h4-9,12H,1-3,10-11,13H2,(H,22,24) |
| InChIKey | UVLIKGNPYRJMNB-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.91 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|