C16H17ClN4O5S — CID 18279258
[2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 4-pyrrolidin-1-ylsulfonyl-1H-pyrrole-2-carboxylate (PubChem CID 18279258) has the molecular formula C16H17ClN4O5S and a molecular weight of 412.86 g/mol. Its IUPAC name is [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 4-pyrrolidin-1-ylsulfonyl-1H-pyrrole-2-carboxylate.
| Compound Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 4-pyrrolidin-1-ylsulfonyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 18279258 |
| Molecular Formula | C16H17ClN4O5S |
| Molecular Weight | 412.86 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 4-pyrrolidin-1-ylsulfonyl-1H-pyrrole-2-carboxylate |
| SMILES | O=C(COC(=O)c1cc(S(=O)(=O)N2CCCC2)c[nH]1)Nc1cccnc1Cl |
| InChI | InChI=1S/C16H17ClN4O5S/c17-15-12(4-3-5-18-15)20-14(22)10-26-16(23)13-8-11(9-19-13)27(24,25)21-6-1-2-7-21/h3-5,8-9,19H,1-2,6-7,10H2,(H,20,22) |
| InChIKey | VYJNKIRJKDYTIX-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 121.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.86 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|