C18H16ClN3O3 — CID 46663539
[2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 4,6-dimethyl-1H-indole-2-carboxylate (PubChem CID 46663539) has the molecular formula C18H16ClN3O3 and a molecular weight of 357.80 g/mol. Its IUPAC name is [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 4,6-dimethyl-1H-indole-2-carboxylate.
| Compound Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 4,6-dimethyl-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 46663539 |
| Molecular Formula | C18H16ClN3O3 |
| Molecular Weight | 357.80 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 4,6-dimethyl-1H-indole-2-carboxylate |
| SMILES | Cc1cc(C)c2cc(C(=O)OCC(=O)Nc3cccnc3Cl)[nH]c2c1 |
| InChI | InChI=1S/C18H16ClN3O3/c1-10-6-11(2)12-8-15(21-14(12)7-10)18(24)25-9-16(23)22-13-4-3-5-20-17(13)19/h3-8,21H,9H2,1-2H3,(H,22,23) |
| InChIKey | NRPKPAQOABMDDT-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.80 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|