C14H12ClN3O3 — CID 31172090
[2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 6-methylpyridine-3-carboxylate (PubChem CID 31172090) has the molecular formula C14H12ClN3O3 and a molecular weight of 305.72 g/mol. Its IUPAC name is [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 6-methylpyridine-3-carboxylate.
| Compound Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 6-methylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 31172090 |
| Molecular Formula | C14H12ClN3O3 |
| Molecular Weight | 305.72 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 6-methylpyridine-3-carboxylate |
| SMILES | Cc1ccc(C(=O)OCC(=O)Nc2cccnc2Cl)cn1 |
| InChI | InChI=1S/C14H12ClN3O3/c1-9-4-5-10(7-17-9)14(20)21-8-12(19)18-11-3-2-6-16-13(11)15/h2-7H,8H2,1H3,(H,18,19) |
| InChIKey | FSBDSUNKRVZWCN-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.72 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|